C14H12N2O4 — CID 141085940
4-phenyldiazenylcyclohexa-1,5-diene-1,4-dicarboxylic acid (PubChem CID 141085940) has the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. Its IUPAC name is 4-phenyldiazenylcyclohexa-1,5-diene-1,4-dicarboxylic acid.
| Compound Name | 4-phenyldiazenylcyclohexa-1,5-diene-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 141085940 |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 4-phenyldiazenylcyclohexa-1,5-diene-1,4-dicarboxylic acid |
| SMILES | O=C(O)C1=CCC(/N=N/c2ccccc2)(C(=O)O)C=C1 |
| InChI | InChI=1S/C14H12N2O4/c17-12(18)10-6-8-14(9-7-10,13(19)20)16-15-11-4-2-1-3-5-11/h1-8H,9H2,(H,17,18)(H,19,20)/b16-15+ |
| InChIKey | XDKICQJVOKGMSD-FOCLMDBBSA-N |
| XLogP | 2.56 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|