C12H15ClN4 — CID 160755831
4-phenyldiazenylcyclohexa-1,5-diene-1,4-diamine;hydrochloride (PubChem CID 160755831) has the molecular formula C12H15ClN4 and a molecular weight of 250.73 g/mol. Its IUPAC name is 4-phenyldiazenylcyclohexa-1,5-diene-1,4-diamine;hydrochloride.
| Compound Name | 4-phenyldiazenylcyclohexa-1,5-diene-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 160755831 |
| Molecular Formula | C12H15ClN4 |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 4-phenyldiazenylcyclohexa-1,5-diene-1,4-diamine;hydrochloride |
| SMILES | Cl.NC1=CCC(N)(/N=N/c2ccccc2)C=C1 |
| InChI | InChI=1S/C12H14N4.ClH/c13-10-6-8-12(14,9-7-10)16-15-11-4-2-1-3-5-11;/h1-8H,9,13-14H2;1H/b16-15+; |
| InChIKey | MELLLOQJJWXIGU-GEEYTBSJSA-N |
| XLogP | 2.65 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|