C12H11N3O3 — CID 141317059
1-nitro-4-phenyldiazenylcyclohexa-2,4-dien-1-ol (PubChem CID 141317059) has the molecular formula C12H11N3O3 and a molecular weight of 245.24 g/mol. Its IUPAC name is 1-nitro-4-phenyldiazenylcyclohexa-2,4-dien-1-ol.
| Compound Name | 1-nitro-4-phenyldiazenylcyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 141317059 |
| Molecular Formula | C12H11N3O3 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 1-nitro-4-phenyldiazenylcyclohexa-2,4-dien-1-ol |
| SMILES | O=[N+]([O-])C1(O)C=CC(/N=N/c2ccccc2)=CC1 |
| InChI | InChI=1S/C12H11N3O3/c16-12(15(17)18)8-6-11(7-9-12)14-13-10-4-2-1-3-5-10/h1-8,16H,9H2/b14-13+ |
| InChIKey | FMEFSUYDHIYEBI-BUHFOSPRSA-N |
| XLogP | 2.58 |
| TPSA | 88.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|