C24H20N4O4 — CID 86752884
4-(N-[4-hydroxy-4-[(4-nitrophenyl)diazenyl]cyclohexa-1,5-dien-1-yl]anilino)phenol (PubChem CID 86752884) has the molecular formula C24H20N4O4 and a molecular weight of 428.45 g/mol. Its IUPAC name is 4-(N-[4-hydroxy-4-[(4-nitrophenyl)diazenyl]cyclohexa-1,5-dien-1-yl]anilino)phenol.
| Compound Name | 4-(N-[4-hydroxy-4-[(4-nitrophenyl)diazenyl]cyclohexa-1,5-dien-1-yl]anilino)phenol |
|---|---|
| PubChem CID | 86752884 |
| Molecular Formula | C24H20N4O4 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 4-(N-[4-hydroxy-4-[(4-nitrophenyl)diazenyl]cyclohexa-1,5-dien-1-yl]anilino)phenol |
| SMILES | O=[N+]([O-])c1ccc(/N=N/C2(O)C=CC(N(c3ccccc3)c3ccc(O)cc3)=CC2)cc1 |
| InChI | InChI=1S/C24H20N4O4/c29-23-12-10-20(11-13-23)27(19-4-2-1-3-5-19)21-14-16-24(30,17-15-21)26-25-18-6-8-22(9-7-18)28(31)32/h1-16,29-30H,17H2/b26-25+ |
| InChIKey | ONNAQQDAGIJBLK-OCEACIFDSA-N |
| XLogP | 5.75 |
| TPSA | 111.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|