C22H24N6O4 — CID 12828362
[8a-[(4-nitrophenyl)diazenyl]-1,2,3,4,5,6,7,8-octahydronaphthalen-4a-yl]-(4-nitrophenyl)diazene (PubChem CID 12828362) has the molecular formula C22H24N6O4 and a molecular weight of 436.47 g/mol. Its IUPAC name is [8a-[(4-nitrophenyl)diazenyl]-1,2,3,4,5,6,7,8-octahydronaphthalen-4a-yl]-(4-nitrophenyl)diazene.
| Compound Name | [8a-[(4-nitrophenyl)diazenyl]-1,2,3,4,5,6,7,8-octahydronaphthalen-4a-yl]-(4-nitrophenyl)diazene |
|---|---|
| PubChem CID | 12828362 |
| Molecular Formula | C22H24N6O4 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | [8a-[(4-nitrophenyl)diazenyl]-1,2,3,4,5,6,7,8-octahydronaphthalen-4a-yl]-(4-nitrophenyl)diazene |
| SMILES | O=[N+]([O-])c1ccc(/N=N/C23CCCCC2(/N=N/c2ccc([N+](=O)[O-])cc2)CCCC3)cc1 |
| InChI | InChI=1S/C22H24N6O4/c29-27(30)19-9-5-17(6-10-19)23-25-21-13-1-2-14-22(21,16-4-3-15-21)26-24-18-7-11-20(12-8-18)28(31)32/h5-12H,1-4,13-16H2/b25-23+,26-24+ |
| InChIKey | IUARWSHXHKGZAU-OGGGYYITSA-N |
| XLogP | 7.00 |
| TPSA | 135.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|