C10H8N4O4 — CID 135510190
2-(4-nitrophenyl)imino-1,3-diazinane-4,6-dione (PubChem CID 135510190) has the molecular formula C10H8N4O4 and a molecular weight of 248.20 g/mol. Its IUPAC name is 2-(4-nitrophenyl)imino-1,3-diazinane-4,6-dione.
| Compound Name | 2-(4-nitrophenyl)imino-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 135510190 |
| Molecular Formula | C10H8N4O4 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 2-(4-nitrophenyl)imino-1,3-diazinane-4,6-dione |
| SMILES | O=C1CC(=O)NC(=Nc2ccc([N+](=O)[O-])cc2)N1 |
| InChI | InChI=1S/C10H8N4O4/c15-8-5-9(16)13-10(12-8)11-6-1-3-7(4-2-6)14(17)18/h1-4H,5H2,(H2,11,12,13,15,16) |
| InChIKey | MLBSISPVJBUJRY-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|