C19H20N6O4 — CID 13112667
(4-nitrophenyl)-[3,4,4,5-tetramethyl-2-(4-nitrophenyl)pyrazol-3-yl]diazene (PubChem CID 13112667) has the molecular formula C19H20N6O4 and a molecular weight of 396.41 g/mol. Its IUPAC name is (4-nitrophenyl)-[3,4,4,5-tetramethyl-2-(4-nitrophenyl)pyrazol-3-yl]diazene.
| Compound Name | (4-nitrophenyl)-[3,4,4,5-tetramethyl-2-(4-nitrophenyl)pyrazol-3-yl]diazene |
|---|---|
| PubChem CID | 13112667 |
| Molecular Formula | C19H20N6O4 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | (4-nitrophenyl)-[3,4,4,5-tetramethyl-2-(4-nitrophenyl)pyrazol-3-yl]diazene |
| SMILES | CC1=NN(c2ccc([N+](=O)[O-])cc2)C(C)(/N=N/c2ccc([N+](=O)[O-])cc2)C1(C)C |
| InChI | InChI=1S/C19H20N6O4/c1-13-18(2,3)19(4,22-20-14-5-7-16(8-6-14)24(26)27)23(21-13)15-9-11-17(12-10-15)25(28)29/h5-12H,1-4H3/b22-20+ |
| InChIKey | WVZDUFILEGOEGM-LSDHQDQOSA-N |
| XLogP | 5.23 |
| TPSA | 126.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|