C19H22N4 — CID 13112669
phenyl-(3,4,4,5-tetramethyl-2-phenylpyrazol-3-yl)diazene (PubChem CID 13112669) has the molecular formula C19H22N4 and a molecular weight of 306.41 g/mol. Its IUPAC name is phenyl-(3,4,4,5-tetramethyl-2-phenylpyrazol-3-yl)diazene.
| Compound Name | phenyl-(3,4,4,5-tetramethyl-2-phenylpyrazol-3-yl)diazene |
|---|---|
| PubChem CID | 13112669 |
| Molecular Formula | C19H22N4 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | phenyl-(3,4,4,5-tetramethyl-2-phenylpyrazol-3-yl)diazene |
| SMILES | CC1=NN(c2ccccc2)C(C)(/N=N/c2ccccc2)C1(C)C |
| InChI | InChI=1S/C19H22N4/c1-15-18(2,3)19(4,22-20-16-11-7-5-8-12-16)23(21-15)17-13-9-6-10-14-17/h5-14H,1-4H3/b22-20+ |
| InChIKey | OVVWKWQGZAMAJE-LSDHQDQOSA-N |
| XLogP | 5.41 |
| TPSA | 40.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|