C11H11N5O2 — CID 155272345
(3,5-dimethyl-1H-pyrazol-4-yl)-(4-nitrophenyl)diazene (PubChem CID 155272345) has the molecular formula C11H11N5O2 and a molecular weight of 245.24 g/mol. Its IUPAC name is (3,5-dimethyl-1H-pyrazol-4-yl)-(4-nitrophenyl)diazene.
| Compound Name | (3,5-dimethyl-1H-pyrazol-4-yl)-(4-nitrophenyl)diazene |
|---|---|
| PubChem CID | 155272345 |
| Molecular Formula | C11H11N5O2 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | (3,5-dimethyl-1H-pyrazol-4-yl)-(4-nitrophenyl)diazene |
| SMILES | Cc1n[nH]c(C)c1/N=N/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H11N5O2/c1-7-11(8(2)13-12-7)15-14-9-3-5-10(6-4-9)16(17)18/h3-6H,1-2H3,(H,12,13)/b15-14+ |
| InChIKey | OJNVJAJPZYKYGG-CCEZHUSRSA-N |
| XLogP | 3.35 |
| TPSA | 96.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|