C11H10N4O5 — CID 136714635
3-(methoxymethyl)-4-[(4-nitrophenyl)diazenyl]-2H-1,2-oxazol-5-one (PubChem CID 136714635) has the molecular formula C11H10N4O5 and a molecular weight of 278.22 g/mol. Its IUPAC name is 3-(methoxymethyl)-4-[(4-nitrophenyl)diazenyl]-2H-1,2-oxazol-5-one.
| Compound Name | 3-(methoxymethyl)-4-[(4-nitrophenyl)diazenyl]-2H-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 136714635 |
| Molecular Formula | C11H10N4O5 |
| Molecular Weight | 278.22 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 3-(methoxymethyl)-4-[(4-nitrophenyl)diazenyl]-2H-1,2-oxazol-5-one |
| SMILES | COCc1[nH]oc(=O)c1/N=N/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H10N4O5/c1-19-6-9-10(11(16)20-14-9)13-12-7-2-4-8(5-3-7)15(17)18/h2-5,14H,6H2,1H3/b13-12+ |
| InChIKey | ISOLXUXEDOUGKY-OUKQBFOZSA-N |
| XLogP | 2.44 |
| TPSA | 123.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|