C12H11N5O5 — CID 535986
6-hydroxy-1,3-dimethyl-5-[(4-nitrophenyl)diazenyl]pyrimidine-2,4-dione (PubChem CID 535986) has the molecular formula C12H11N5O5 and a molecular weight of 305.25 g/mol. Its IUPAC name is 6-hydroxy-1,3-dimethyl-5-[(4-nitrophenyl)diazenyl]pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-1,3-dimethyl-5-[(4-nitrophenyl)diazenyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 535986 |
| Molecular Formula | C12H11N5O5 |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 6-hydroxy-1,3-dimethyl-5-[(4-nitrophenyl)diazenyl]pyrimidine-2,4-dione |
| SMILES | Cn1c(O)c(/N=N/c2ccc([N+](=O)[O-])cc2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C12H11N5O5/c1-15-10(18)9(11(19)16(2)12(15)20)14-13-7-3-5-8(6-4-7)17(21)22/h3-6,18H,1-2H3/b14-13+ |
| InChIKey | DBGSXJGUIVIBFC-BUHFOSPRSA-N |
| XLogP | 1.11 |
| TPSA | 132.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|