C21H20N4O6S — CID 137093808
(4-nitrophenyl)methyl 4-hydroxy-N-(4-methoxyphenyl)-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate (PubChem CID 137093808) has the molecular formula C21H20N4O6S and a molecular weight of 456.48 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 4-hydroxy-N-(4-methoxyphenyl)-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate.
| Compound Name | (4-nitrophenyl)methyl 4-hydroxy-N-(4-methoxyphenyl)-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
|---|---|
| PubChem CID | 137093808 |
| Molecular Formula | C21H20N4O6S |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | (4-nitrophenyl)methyl 4-hydroxy-N-(4-methoxyphenyl)-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
| SMILES | COc1ccc(/N=C(\SCc2ccc([N+](=O)[O-])cc2)c2c(O)n(C)c(=O)n(C)c2=O)cc1 |
| InChI | InChI=1S/C21H20N4O6S/c1-23-19(26)17(20(27)24(2)21(23)28)18(22-14-6-10-16(31-3)11-7-14)32-12-13-4-8-15(9-5-13)25(29)30/h4-11,26H,12H2,1-3H3/b22-18- |
| InChIKey | XTQBXAIVZKQTOM-PYCFMQQDSA-N |
| XLogP | 2.72 |
| TPSA | 128.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|