C13H15N3O4 — CID 170913537
4-[[4-(2-methoxyethoxy)phenyl]diazenyl]-3-methyl-2H-1,2-oxazol-5-one (PubChem CID 170913537) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is 4-[[4-(2-methoxyethoxy)phenyl]diazenyl]-3-methyl-2H-1,2-oxazol-5-one.
| Compound Name | 4-[[4-(2-methoxyethoxy)phenyl]diazenyl]-3-methyl-2H-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 170913537 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 4-[[4-(2-methoxyethoxy)phenyl]diazenyl]-3-methyl-2H-1,2-oxazol-5-one |
| SMILES | COCCOc1ccc(/N=N/c2c(C)[nH]oc2=O)cc1 |
| InChI | InChI=1S/C13H15N3O4/c1-9-12(13(17)20-16-9)15-14-10-3-5-11(6-4-10)19-8-7-18-2/h3-6,16H,7-8H2,1-2H3/b15-14+ |
| InChIKey | KUNZQRATACNHMS-CCEZHUSRSA-N |
| XLogP | 2.72 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|