C24H18N2O3 — CID 132556433
4-(4-nitrophenoxy)-N,N-diphenylaniline (PubChem CID 132556433) has the molecular formula C24H18N2O3 and a molecular weight of 382.42 g/mol. Its IUPAC name is 4-(4-nitrophenoxy)-N,N-diphenylaniline.
| Compound Name | 4-(4-nitrophenoxy)-N,N-diphenylaniline |
|---|---|
| PubChem CID | 132556433 |
| Molecular Formula | C24H18N2O3 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 4-(4-nitrophenoxy)-N,N-diphenylaniline |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccc(N(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H18N2O3/c27-26(28)22-13-17-24(18-14-22)29-23-15-11-21(12-16-23)25(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-18H |
| InChIKey | CQMYLSZRNGYGKN-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|