C54H36N4O6 — CID 59757686
4-[3-(4-nitrophenyl)phenyl]-N,N-bis[4-[3-(4-nitrophenyl)phenyl]phenyl]aniline (PubChem CID 59757686) has the molecular formula C54H36N4O6 and a molecular weight of 836.90 g/mol. Its IUPAC name is 4-[3-(4-nitrophenyl)phenyl]-N,N-bis[4-[3-(4-nitrophenyl)phenyl]phenyl]aniline.
| Compound Name | 4-[3-(4-nitrophenyl)phenyl]-N,N-bis[4-[3-(4-nitrophenyl)phenyl]phenyl]aniline |
|---|---|
| PubChem CID | 59757686 |
| Molecular Formula | C54H36N4O6 |
| Molecular Weight | 836.90 g/mol |
| Exact Mass | 836.26 |
| IUPAC Name | 4-[3-(4-nitrophenyl)phenyl]-N,N-bis[4-[3-(4-nitrophenyl)phenyl]phenyl]aniline |
| SMILES | O=[N+]([O-])c1ccc(-c2cccc(-c3ccc(N(c4ccc(-c5cccc(-c6ccc([N+](=O)[O-])cc6)c5)cc4)c4ccc(-c5cccc(-c6ccc([N+](=O)[O-])cc6)c5)cc4)cc3)c2)cc1 |
| InChI | InChI=1S/C54H36N4O6/c59-56(60)52-28-16-40(17-29-52)46-7-1-4-43(34-46)37-10-22-49(23-11-37)55(50-24-12-38(13-25-50)44-5-2-8-47(35-44)41-18-30-53(31-19-41)57(61)62)51-26-14-39(15-27-51)45-6-3-9-48(36-45)42-20-32-54(33-21-42)58(63)64/h1-36H |
| InChIKey | GJAJHZQSAUDRHX-UHFFFAOYSA-N |
| XLogP | 14.88 |
| TPSA | 132.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.90 |
| LogP ≤ 5 | 14.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|