C43H33N3O2 — CID 59431971
N-[4-[4-(N-methyl-3-nitroanilino)phenyl]phenyl]-3-phenyl-N-(3-phenylphenyl)aniline (PubChem CID 59431971) has the molecular formula C43H33N3O2 and a molecular weight of 623.76 g/mol. Its IUPAC name is N-[4-[4-(N-methyl-3-nitroanilino)phenyl]phenyl]-3-phenyl-N-(3-phenylphenyl)aniline.
| Compound Name | N-[4-[4-(N-methyl-3-nitroanilino)phenyl]phenyl]-3-phenyl-N-(3-phenylphenyl)aniline |
|---|---|
| PubChem CID | 59431971 |
| Molecular Formula | C43H33N3O2 |
| Molecular Weight | 623.76 g/mol |
| Exact Mass | 623.26 |
| IUPAC Name | N-[4-[4-(N-methyl-3-nitroanilino)phenyl]phenyl]-3-phenyl-N-(3-phenylphenyl)aniline |
| SMILES | CN(c1ccc(-c2ccc(N(c3cccc(-c4ccccc4)c3)c3cccc(-c4ccccc4)c3)cc2)cc1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C43H33N3O2/c1-44(40-17-10-20-43(31-40)46(47)48)38-25-21-34(22-26-38)35-23-27-39(28-24-35)45(41-18-8-15-36(29-41)32-11-4-2-5-12-32)42-19-9-16-37(30-42)33-13-6-3-7-14-33/h2-31H,1H3 |
| InChIKey | AJDRKZDCDAQIDB-UHFFFAOYSA-N |
| XLogP | 11.83 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.76 |
| LogP ≤ 5 | 11.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|