C39H33N3O2 — CID 71090901
2-N-methyl-2-N-(3-nitrophenyl)-5-N,5-N-bis(3-phenylphenyl)bicyclo[4.2.0]octa-2,4-diene-2,5-diamine (PubChem CID 71090901) has the molecular formula C39H33N3O2 and a molecular weight of 575.71 g/mol. Its IUPAC name is 2-N-methyl-2-N-(3-nitrophenyl)-5-N,5-N-bis(3-phenylphenyl)bicyclo[4.2.0]octa-2,4-diene-2,5-diamine.
| Compound Name | 2-N-methyl-2-N-(3-nitrophenyl)-5-N,5-N-bis(3-phenylphenyl)bicyclo[4.2.0]octa-2,4-diene-2,5-diamine |
|---|---|
| PubChem CID | 71090901 |
| Molecular Formula | C39H33N3O2 |
| Molecular Weight | 575.71 g/mol |
| Exact Mass | 575.26 |
| IUPAC Name | 2-N-methyl-2-N-(3-nitrophenyl)-5-N,5-N-bis(3-phenylphenyl)bicyclo[4.2.0]octa-2,4-diene-2,5-diamine |
| SMILES | CN(C1=CC=C(N(c2cccc(-c3ccccc3)c2)c2cccc(-c3ccccc3)c2)C2CCC12)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C39H33N3O2/c1-40(32-17-10-20-35(27-32)42(43)44)38-23-24-39(37-22-21-36(37)38)41(33-18-8-15-30(25-33)28-11-4-2-5-12-28)34-19-9-16-31(26-34)29-13-6-3-7-14-29/h2-20,23-27,36-37H,21-22H2,1H3 |
| InChIKey | ZYIYCCKISUPWKF-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.71 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|