C18H14N4O4 — CID 176657563
4-nitro-1-N-(4-nitrophenyl)-1-N-phenylbenzene-1,2-diamine (PubChem CID 176657563) has the molecular formula C18H14N4O4 and a molecular weight of 350.33 g/mol. Its IUPAC name is 4-nitro-1-N-(4-nitrophenyl)-1-N-phenylbenzene-1,2-diamine.
| Compound Name | 4-nitro-1-N-(4-nitrophenyl)-1-N-phenylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 176657563 |
| Molecular Formula | C18H14N4O4 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 4-nitro-1-N-(4-nitrophenyl)-1-N-phenylbenzene-1,2-diamine |
| SMILES | Nc1cc([N+](=O)[O-])ccc1N(c1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H14N4O4/c19-17-12-16(22(25)26)10-11-18(17)20(13-4-2-1-3-5-13)14-6-8-15(9-7-14)21(23)24/h1-12H,19H2 |
| InChIKey | LINIZSABOGVAKW-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 115.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|