C32H24N6O8 — CID 89352542
2,5-dimethyl-1-N,1-N,4-N,4-N-tetrakis(4-nitrophenyl)benzene-1,4-diamine (PubChem CID 89352542) has the molecular formula C32H24N6O8 and a molecular weight of 620.58 g/mol. Its IUPAC name is 2,5-dimethyl-1-N,1-N,4-N,4-N-tetrakis(4-nitrophenyl)benzene-1,4-diamine.
| Compound Name | 2,5-dimethyl-1-N,1-N,4-N,4-N-tetrakis(4-nitrophenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 89352542 |
| Molecular Formula | C32H24N6O8 |
| Molecular Weight | 620.58 g/mol |
| Exact Mass | 620.17 |
| IUPAC Name | 2,5-dimethyl-1-N,1-N,4-N,4-N-tetrakis(4-nitrophenyl)benzene-1,4-diamine |
| SMILES | Cc1cc(N(c2ccc([N+](=O)[O-])cc2)c2ccc([N+](=O)[O-])cc2)c(C)cc1N(c1ccc([N+](=O)[O-])cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C32H24N6O8/c1-21-19-32(34(25-7-15-29(16-8-25)37(43)44)26-9-17-30(18-10-26)38(45)46)22(2)20-31(21)33(23-3-11-27(12-4-23)35(39)40)24-5-13-28(14-6-24)36(41)42/h3-20H,1-2H3 |
| InChIKey | ODYQALCBBWKQTF-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 179.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.58 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|