About 3,5-difluoro-N,N-bis(4-nitrophenyl)aniline
3,5-difluoro-N,N-bis(4-nitrophenyl)aniline (PubChem CID 177256048) has the molecular formula C18H11F2N3O4
and a molecular weight of 371.30 g/mol. Its IUPAC name is 3,5-difluoro-N,N-bis(4-nitrophenyl)aniline.
Molecular Properties
| Compound Name | 3,5-difluoro-N,N-bis(4-nitrophenyl)aniline |
| PubChem CID | 177256048 |
| Molecular Formula | C18H11F2N3O4 |
| Molecular Weight | 371.30 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 3,5-difluoro-N,N-bis(4-nitrophenyl)aniline |
| SMILES | O=[N+]([O-])c1ccc(N(c2ccc([N+](=O)[O-])cc2)c2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C18H11F2N3O4/c19-12-9-13(20)11-18(10-12)21(14-1-5-16(6-2-14)22(24)25)15-3-7-17(8-4-15)23(26)27/h1-11H |
| InChIKey | XLJYPACYUJIUMJ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.30 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,5-difluoro-N,N-bis(4-nitrophenyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-difluoro-N,N-bis(4-nitrophenyl)aniline?
The IUPAC name of 3,5-difluoro-N,N-bis(4-nitrophenyl)aniline (CID 177256048) is 3,5-difluoro-N,N-bis(4-nitrophenyl)aniline.
What is the SMILES notation for 3,5-difluoro-N,N-bis(4-nitrophenyl)aniline?
The canonical SMILES for 3,5-difluoro-N,N-bis(4-nitrophenyl)aniline is O=[N+]([O-])c1ccc(N(c2ccc([N+](=O)[O-])cc2)c2cc(F)cc(F)c2)cc1.
What is the InChIKey of 3,5-difluoro-N,N-bis(4-nitrophenyl)aniline?
The InChIKey is XLJYPACYUJIUMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11F2N3O4/c19-12-9-13(20)11-18(10-12)21(14-1-5-16(6-2-14)22(24)25)15-3-7-17(8-4-15)23(26)27/h1-11H.
What are the key properties of 3,5-difluoro-N,N-bis(4-nitrophenyl)aniline?
3,5-difluoro-N,N-bis(4-nitrophenyl)aniline has a molecular weight of 371.30 g/mol, XLogP of 5.25, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-difluoro-N,N-bis(4-nitrophenyl)aniline is sourced from PubChem (CID 177256048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).