C38H50N2O14 — CID 139125077
N-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yl)-N-(4-nitrophenyl)-2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-amine (PubChem CID 139125077) has the molecular formula C38H50N2O14 and a molecular weight of 758.82 g/mol. Its IUPAC name is N-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yl)-N-(4-nitrophenyl)-2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-amine.
| Compound Name | N-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yl)-N-(4-nitrophenyl)-2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-amine |
|---|---|
| PubChem CID | 139125077 |
| Molecular Formula | C38H50N2O14 |
| Molecular Weight | 758.82 g/mol |
| Exact Mass | 758.33 |
| IUPAC Name | N-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yl)-N-(4-nitrophenyl)-2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-amine |
| SMILES | O=[N+]([O-])c1ccc(N(c2ccc3c(c2)OCCOCCOCCOCCOCCO3)c2ccc3c(c2)OCCOCCOCCOCCOCCO3)cc1 |
| InChI | InChI=1S/C38H50N2O14/c41-40(42)32-3-1-31(2-4-32)39(33-5-7-35-37(29-33)53-27-23-49-19-15-45-11-9-43-13-17-47-21-25-51-35)34-6-8-36-38(30-34)54-28-24-50-20-16-46-12-10-44-14-18-48-22-26-52-36/h1-8,29-30H,9-28H2 |
| InChIKey | HVTOLKDYABIDOG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 157.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.82 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|