C20H17N5O6 — CID 174475493
4-N,4-N-bis(2,3-dihydro-1,4-benzodioxin-6-yl)-5-nitropyrimidine-2,4-diamine (PubChem CID 174475493) has the molecular formula C20H17N5O6 and a molecular weight of 423.39 g/mol. Its IUPAC name is 4-N,4-N-bis(2,3-dihydro-1,4-benzodioxin-6-yl)-5-nitropyrimidine-2,4-diamine.
| Compound Name | 4-N,4-N-bis(2,3-dihydro-1,4-benzodioxin-6-yl)-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 174475493 |
| Molecular Formula | C20H17N5O6 |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 4-N,4-N-bis(2,3-dihydro-1,4-benzodioxin-6-yl)-5-nitropyrimidine-2,4-diamine |
| SMILES | Nc1ncc([N+](=O)[O-])c(N(c2ccc3c(c2)OCCO3)c2ccc3c(c2)OCCO3)n1 |
| InChI | InChI=1S/C20H17N5O6/c21-20-22-11-14(25(26)27)19(23-20)24(12-1-3-15-17(9-12)30-7-5-28-15)13-2-4-16-18(10-13)31-8-6-29-16/h1-4,9-11H,5-8H2,(H2,21,22,23) |
| InChIKey | QQBJWFAINUERFW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 135.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|