C20H24N2O8 — CID 11058876
12-nitro-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(26),9(14),10,12,22,24-hexaen-11-amine (PubChem CID 11058876) has the molecular formula C20H24N2O8 and a molecular weight of 420.42 g/mol. Its IUPAC name is 12-nitro-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(26),9(14),10,12,22,24-hexaen-11-amine.
| Compound Name | 12-nitro-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(26),9(14),10,12,22,24-hexaen-11-amine |
|---|---|
| PubChem CID | 11058876 |
| Molecular Formula | C20H24N2O8 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 12-nitro-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(26),9(14),10,12,22,24-hexaen-11-amine |
| SMILES | Nc1cc2c(cc1[N+](=O)[O-])OCCOCCOc1ccccc1OCCOCCO2 |
| InChI | InChI=1S/C20H24N2O8/c21-15-13-19-20(14-16(15)22(23)24)30-12-8-26-6-10-28-18-4-2-1-3-17(18)27-9-5-25-7-11-29-19/h1-4,13-14H,5-12,21H2 |
| InChIKey | NCBUHNOZOWMUSZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 124.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|