About N,N-dichloro-4-nitroaniline;molecular nitrogen
N,N-dichloro-4-nitroaniline;molecular nitrogen (PubChem CID 174775109) has the molecular formula C6H4Cl2N4O2
and a molecular weight of 235.03 g/mol. Its IUPAC name is N,N-dichloro-4-nitroaniline;molecular nitrogen.
Molecular Properties
| Compound Name | N,N-dichloro-4-nitroaniline;molecular nitrogen |
| PubChem CID | 174775109 |
| Molecular Formula | C6H4Cl2N4O2 |
| Molecular Weight | 235.03 g/mol |
| Exact Mass | 233.97 |
| IUPAC Name | N,N-dichloro-4-nitroaniline;molecular nitrogen |
| SMILES | N#N.O=[N+]([O-])c1ccc(N(Cl)Cl)cc1 |
| InChI | InChI=1S/C6H4Cl2N2O2.N2/c7-9(8)5-1-3-6(4-2-5)10(11)12;1-2/h1-4H; |
| InChIKey | ZKULABGLCOXERJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 93.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.03 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-dichloro-4-nitroaniline;molecular nitrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dichloro-4-nitroaniline;molecular nitrogen?
The IUPAC name of N,N-dichloro-4-nitroaniline;molecular nitrogen (CID 174775109) is N,N-dichloro-4-nitroaniline;molecular nitrogen.
What is the SMILES notation for N,N-dichloro-4-nitroaniline;molecular nitrogen?
The canonical SMILES for N,N-dichloro-4-nitroaniline;molecular nitrogen is N#N.O=[N+]([O-])c1ccc(N(Cl)Cl)cc1.
What is the InChIKey of N,N-dichloro-4-nitroaniline;molecular nitrogen?
The InChIKey is ZKULABGLCOXERJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl2N2O2.N2/c7-9(8)5-1-3-6(4-2-5)10(11)12;1-2/h1-4H;.
What are the key properties of N,N-dichloro-4-nitroaniline;molecular nitrogen?
N,N-dichloro-4-nitroaniline;molecular nitrogen has a molecular weight of 235.03 g/mol, XLogP of 2.74, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dichloro-4-nitroaniline;molecular nitrogen is sourced from PubChem (CID 174775109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).