About isothiocyanic acid;1-nitro-4-phenoxybenzene
isothiocyanic acid;1-nitro-4-phenoxybenzene (PubChem CID 87949800) has the molecular formula C13H10N2O3S
and a molecular weight of 274.30 g/mol. Its IUPAC name is isothiocyanic acid;1-nitro-4-phenoxybenzene.
Molecular Properties
| Compound Name | isothiocyanic acid;1-nitro-4-phenoxybenzene |
| PubChem CID | 87949800 |
| Molecular Formula | C13H10N2O3S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | isothiocyanic acid;1-nitro-4-phenoxybenzene |
| SMILES | N=C=S.O=[N+]([O-])c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C12H9NO3.CHNS/c14-13(15)10-6-8-12(9-7-10)16-11-4-2-1-3-5-11;2-1-3/h1-9H;2H |
| InChIKey | KIIXFKDYFFMDSQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze isothiocyanic acid;1-nitro-4-phenoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isothiocyanic acid;1-nitro-4-phenoxybenzene?
The IUPAC name of isothiocyanic acid;1-nitro-4-phenoxybenzene (CID 87949800) is isothiocyanic acid;1-nitro-4-phenoxybenzene.
What is the SMILES notation for isothiocyanic acid;1-nitro-4-phenoxybenzene?
The canonical SMILES for isothiocyanic acid;1-nitro-4-phenoxybenzene is N=C=S.O=[N+]([O-])c1ccc(Oc2ccccc2)cc1.
What is the InChIKey of isothiocyanic acid;1-nitro-4-phenoxybenzene?
The InChIKey is KIIXFKDYFFMDSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO3.CHNS/c14-13(15)10-6-8-12(9-7-10)16-11-4-2-1-3-5-11;2-1-3/h1-9H;2H.
What are the key properties of isothiocyanic acid;1-nitro-4-phenoxybenzene?
isothiocyanic acid;1-nitro-4-phenoxybenzene has a molecular weight of 274.30 g/mol, XLogP of 4.06, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for isothiocyanic acid;1-nitro-4-phenoxybenzene is sourced from PubChem (CID 87949800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).