C25H17N5O2S — CID 10114905
4-[(6-nitro-1,3-benzothiazol-2-yl)diazenyl]-N,N-diphenylaniline (PubChem CID 10114905) has the molecular formula C25H17N5O2S and a molecular weight of 451.51 g/mol. Its IUPAC name is 4-[(6-nitro-1,3-benzothiazol-2-yl)diazenyl]-N,N-diphenylaniline.
| Compound Name | 4-[(6-nitro-1,3-benzothiazol-2-yl)diazenyl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 10114905 |
| Molecular Formula | C25H17N5O2S |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 4-[(6-nitro-1,3-benzothiazol-2-yl)diazenyl]-N,N-diphenylaniline |
| SMILES | O=[N+]([O-])c1ccc2nc(/N=N/c3ccc(N(c4ccccc4)c4ccccc4)cc3)sc2c1 |
| InChI | InChI=1S/C25H17N5O2S/c31-30(32)22-15-16-23-24(17-22)33-25(26-23)28-27-18-11-13-21(14-12-18)29(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-17H/b28-27+ |
| InChIKey | GMKAATQEQAGDMI-BYYHNAKLSA-N |
| XLogP | 8.09 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|