C25H25N7O5S — CID 90456989
2-[N-(2-cyanoethyl)-4-[(6-nitro-1,3-benzothiazol-2-yl)diazenyl]anilino]ethyl 2-methyl-2-(prop-2-enoylamino)propanoate (PubChem CID 90456989) has the molecular formula C25H25N7O5S and a molecular weight of 535.59 g/mol. Its IUPAC name is 2-[N-(2-cyanoethyl)-4-[(6-nitro-1,3-benzothiazol-2-yl)diazenyl]anilino]ethyl 2-methyl-2-(prop-2-enoylamino)propanoate.
| Compound Name | 2-[N-(2-cyanoethyl)-4-[(6-nitro-1,3-benzothiazol-2-yl)diazenyl]anilino]ethyl 2-methyl-2-(prop-2-enoylamino)propanoate |
|---|---|
| PubChem CID | 90456989 |
| Molecular Formula | C25H25N7O5S |
| Molecular Weight | 535.59 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | 2-[N-(2-cyanoethyl)-4-[(6-nitro-1,3-benzothiazol-2-yl)diazenyl]anilino]ethyl 2-methyl-2-(prop-2-enoylamino)propanoate |
| SMILES | C=CC(=O)NC(C)(C)C(=O)OCCN(CCC#N)c1ccc(/N=N/c2nc3ccc([N+](=O)[O-])cc3s2)cc1 |
| InChI | InChI=1S/C25H25N7O5S/c1-4-22(33)28-25(2,3)23(34)37-15-14-31(13-5-12-26)18-8-6-17(7-9-18)29-30-24-27-20-11-10-19(32(35)36)16-21(20)38-24/h4,6-11,16H,1,5,13-15H2,2-3H3,(H,28,33)/b30-29+ |
| InChIKey | NQFARXGZWZGUFV-QVIHXGFCSA-N |
| XLogP | 4.96 |
| TPSA | 163.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.59 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|