C25H20N6O4 — CID 57348708
2-[N-(2-cyanoethyl)-4-[(2-cyano-3-nitrophenyl)diazenyl]anilino]ethyl benzoate (PubChem CID 57348708) has the molecular formula C25H20N6O4 and a molecular weight of 468.47 g/mol. Its IUPAC name is 2-[N-(2-cyanoethyl)-4-[(2-cyano-3-nitrophenyl)diazenyl]anilino]ethyl benzoate.
| Compound Name | 2-[N-(2-cyanoethyl)-4-[(2-cyano-3-nitrophenyl)diazenyl]anilino]ethyl benzoate |
|---|---|
| PubChem CID | 57348708 |
| Molecular Formula | C25H20N6O4 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 2-[N-(2-cyanoethyl)-4-[(2-cyano-3-nitrophenyl)diazenyl]anilino]ethyl benzoate |
| SMILES | N#CCCN(CCOC(=O)c1ccccc1)c1ccc(/N=N/c2cccc([N+](=O)[O-])c2C#N)cc1 |
| InChI | InChI=1S/C25H20N6O4/c26-14-5-15-30(16-17-35-25(32)19-6-2-1-3-7-19)21-12-10-20(11-13-21)28-29-23-8-4-9-24(31(33)34)22(23)18-27/h1-4,6-13H,5,15-17H2/b29-28+ |
| InChIKey | WNSXIADERNCBPB-ZQHSETAFSA-N |
| XLogP | 5.46 |
| TPSA | 144.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|