C31H30N4O5 — CID 102494691
2-[2-[[4-[bis(pent-1-ynyl)amino]phenyl]diazenyl]-5-nitrophenoxy]ethyl benzoate (PubChem CID 102494691) has the molecular formula C31H30N4O5 and a molecular weight of 538.60 g/mol. Its IUPAC name is 2-[2-[[4-[bis(pent-1-ynyl)amino]phenyl]diazenyl]-5-nitrophenoxy]ethyl benzoate.
| Compound Name | 2-[2-[[4-[bis(pent-1-ynyl)amino]phenyl]diazenyl]-5-nitrophenoxy]ethyl benzoate |
|---|---|
| PubChem CID | 102494691 |
| Molecular Formula | C31H30N4O5 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | 2-[2-[[4-[bis(pent-1-ynyl)amino]phenyl]diazenyl]-5-nitrophenoxy]ethyl benzoate |
| SMILES | CCCC#CN(C#CCCC)c1ccc(/N=N/c2ccc([N+](=O)[O-])cc2OCCOC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H30N4O5/c1-3-5-10-20-34(21-11-6-4-2)27-16-14-26(15-17-27)32-33-29-19-18-28(35(37)38)24-30(29)39-22-23-40-31(36)25-12-8-7-9-13-25/h7-9,12-19,24H,3-6,22-23H2,1-2H3/b33-32+ |
| InChIKey | CTAYPUSSWGZIOB-ULIFNZDWSA-N |
| XLogP | 7.57 |
| TPSA | 106.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|