C33H28N8O9 — CID 88867129
2-[4-[[2-[2-[(3-isocyanatophenyl)carbamoyloxy]ethoxy]-4-nitrophenyl]diazenyl]-N-methylanilino]ethyl N-(3-isocyanatophenyl)carbamate (PubChem CID 88867129) has the molecular formula C33H28N8O9 and a molecular weight of 680.63 g/mol. Its IUPAC name is 2-[4-[[2-[2-[(3-isocyanatophenyl)carbamoyloxy]ethoxy]-4-nitrophenyl]diazenyl]-N-methylanilino]ethyl N-(3-isocyanatophenyl)carbamate.
| Compound Name | 2-[4-[[2-[2-[(3-isocyanatophenyl)carbamoyloxy]ethoxy]-4-nitrophenyl]diazenyl]-N-methylanilino]ethyl N-(3-isocyanatophenyl)carbamate |
|---|---|
| PubChem CID | 88867129 |
| Molecular Formula | C33H28N8O9 |
| Molecular Weight | 680.63 g/mol |
| Exact Mass | 680.20 |
| IUPAC Name | 2-[4-[[2-[2-[(3-isocyanatophenyl)carbamoyloxy]ethoxy]-4-nitrophenyl]diazenyl]-N-methylanilino]ethyl N-(3-isocyanatophenyl)carbamate |
| SMILES | CN(CCOC(=O)Nc1cccc(N=C=O)c1)c1ccc(/N=N/c2ccc([N+](=O)[O-])cc2OCCOC(=O)Nc2cccc(N=C=O)c2)cc1 |
| InChI | InChI=1S/C33H28N8O9/c1-40(14-15-49-32(44)36-26-6-2-4-24(18-26)34-21-42)28-10-8-23(9-11-28)38-39-30-13-12-29(41(46)47)20-31(30)48-16-17-50-33(45)37-27-7-3-5-25(19-27)35-22-43/h2-13,18-20H,14-17H2,1H3,(H,36,44)(H,37,45)/b39-38+ |
| InChIKey | OUGLFPFXDXWPDA-YMZYAJTMSA-N |
| XLogP | 7.26 |
| TPSA | 215.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.63 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|