C22H27Cl2N3O6 — CID 70118603
2-[2-(3-hydroxypropoxy)-4-nitrophenyl]ethyl N-[4-[bis(2-chloroethyl)amino]phenyl]carbamate (PubChem CID 70118603) has the molecular formula C22H27Cl2N3O6 and a molecular weight of 500.38 g/mol. Its IUPAC name is 2-[2-(3-hydroxypropoxy)-4-nitrophenyl]ethyl N-[4-[bis(2-chloroethyl)amino]phenyl]carbamate.
| Compound Name | 2-[2-(3-hydroxypropoxy)-4-nitrophenyl]ethyl N-[4-[bis(2-chloroethyl)amino]phenyl]carbamate |
|---|---|
| PubChem CID | 70118603 |
| Molecular Formula | C22H27Cl2N3O6 |
| Molecular Weight | 500.38 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | 2-[2-(3-hydroxypropoxy)-4-nitrophenyl]ethyl N-[4-[bis(2-chloroethyl)amino]phenyl]carbamate |
| SMILES | O=C(Nc1ccc(N(CCCl)CCCl)cc1)OCCc1ccc([N+](=O)[O-])cc1OCCCO |
| InChI | InChI=1S/C22H27Cl2N3O6/c23-9-11-26(12-10-24)19-6-3-18(4-7-19)25-22(29)33-15-8-17-2-5-20(27(30)31)16-21(17)32-14-1-13-28/h2-7,16,28H,1,8-15H2,(H,25,29) |
| InChIKey | OQTGPDFGRGMULX-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 114.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|