C43H36N4O7 — CID 102381968
2-[N-[2-(naphthalene-1-carbonyloxy)ethyl]-4-[(4-nitro-2-pent-4-ynoxyphenyl)diazenyl]anilino]ethyl naphthalene-1-carboxylate (PubChem CID 102381968) has the molecular formula C43H36N4O7 and a molecular weight of 720.78 g/mol. Its IUPAC name is 2-[N-[2-(naphthalene-1-carbonyloxy)ethyl]-4-[(4-nitro-2-pent-4-ynoxyphenyl)diazenyl]anilino]ethyl naphthalene-1-carboxylate.
| Compound Name | 2-[N-[2-(naphthalene-1-carbonyloxy)ethyl]-4-[(4-nitro-2-pent-4-ynoxyphenyl)diazenyl]anilino]ethyl naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 102381968 |
| Molecular Formula | C43H36N4O7 |
| Molecular Weight | 720.78 g/mol |
| Exact Mass | 720.26 |
| IUPAC Name | 2-[N-[2-(naphthalene-1-carbonyloxy)ethyl]-4-[(4-nitro-2-pent-4-ynoxyphenyl)diazenyl]anilino]ethyl naphthalene-1-carboxylate |
| SMILES | C#CCCCOc1cc([N+](=O)[O-])ccc1/N=N/c1ccc(N(CCOC(=O)c2cccc3ccccc23)CCOC(=O)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C43H36N4O7/c1-2-3-8-27-52-41-30-35(47(50)51)23-24-40(41)45-44-33-19-21-34(22-20-33)46(25-28-53-42(48)38-17-9-13-31-11-4-6-15-36(31)38)26-29-54-43(49)39-18-10-14-32-12-5-7-16-37(32)39/h1,4-7,9-24,30H,3,8,25-29H2/b45-44+ |
| InChIKey | MWFRSTDRJQYNAC-JQOKOOLQSA-N |
| XLogP | 9.63 |
| TPSA | 132.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.78 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|