C54H51N7O8S — CID 139213452
2-[N-(2-benzoyloxyethyl)-4-[(4-nitrophenyl)diazenyl]anilino]ethyl 4-[5-[4-[(4-ethylsulfonylphenyl)diazenyl]-N-pent-4-ynylanilino]pent-1-ynyl]benzoate (PubChem CID 139213452) has the molecular formula C54H51N7O8S and a molecular weight of 958.11 g/mol. Its IUPAC name is 2-[N-(2-benzoyloxyethyl)-4-[(4-nitrophenyl)diazenyl]anilino]ethyl 4-[5-[4-[(4-ethylsulfonylphenyl)diazenyl]-N-pent-4-ynylanilino]pent-1-ynyl]benzoate.
| Compound Name | 2-[N-(2-benzoyloxyethyl)-4-[(4-nitrophenyl)diazenyl]anilino]ethyl 4-[5-[4-[(4-ethylsulfonylphenyl)diazenyl]-N-pent-4-ynylanilino]pent-1-ynyl]benzoate |
|---|---|
| PubChem CID | 139213452 |
| Molecular Formula | C54H51N7O8S |
| Molecular Weight | 958.11 g/mol |
| Exact Mass | 957.35 |
| IUPAC Name | 2-[N-(2-benzoyloxyethyl)-4-[(4-nitrophenyl)diazenyl]anilino]ethyl 4-[5-[4-[(4-ethylsulfonylphenyl)diazenyl]-N-pent-4-ynylanilino]pent-1-ynyl]benzoate |
| SMILES | C#CCCCN(CCCC#Cc1ccc(C(=O)OCCN(CCOC(=O)c2ccccc2)c2ccc(/N=N/c3ccc([N+](=O)[O-])cc3)cc2)cc1)c1ccc(/N=N/c2ccc(S(=O)(=O)CC)cc2)cc1 |
| InChI | InChI=1S/C54H51N7O8S/c1-3-5-11-36-59(49-28-20-45(21-29-49)56-58-48-26-34-52(35-27-48)70(66,67)4-2)37-12-7-8-13-42-16-18-44(19-17-42)54(63)69-41-39-60(38-40-68-53(62)43-14-9-6-10-15-43)50-30-22-46(23-31-50)55-57-47-24-32-51(33-25-47)61(64)65/h1,6,9-10,14-35H,4-5,7,11-12,36-41H2,2H3/b57-55+,58-56+ |
| InChIKey | AWXBRDACOWOXHA-NCCSDIRBSA-N |
| XLogP | 11.79 |
| TPSA | 185.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 958.11 |
| LogP ≤ 5 | 11.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|