C19H14N8O4S — CID 155699072
[5-[[4-[bis(2-cyanoethyl)amino]phenyl]diazenyl]-2,4-dinitrophenyl] thiocyanate (PubChem CID 155699072) has the molecular formula C19H14N8O4S and a molecular weight of 450.44 g/mol. Its IUPAC name is [5-[[4-[bis(2-cyanoethyl)amino]phenyl]diazenyl]-2,4-dinitrophenyl] thiocyanate.
| Compound Name | [5-[[4-[bis(2-cyanoethyl)amino]phenyl]diazenyl]-2,4-dinitrophenyl] thiocyanate |
|---|---|
| PubChem CID | 155699072 |
| Molecular Formula | C19H14N8O4S |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | [5-[[4-[bis(2-cyanoethyl)amino]phenyl]diazenyl]-2,4-dinitrophenyl] thiocyanate |
| SMILES | N#CCCN(CCC#N)c1ccc(/N=N/c2cc(SC#N)c([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H14N8O4S/c20-7-1-9-25(10-2-8-21)15-5-3-14(4-6-15)23-24-16-11-19(32-13-22)18(27(30)31)12-17(16)26(28)29/h3-6,11-12H,1-2,9-10H2/b24-23+ |
| InChIKey | OOFPGCHUZPTICJ-WCWDXBQESA-N |
| XLogP | 5.13 |
| TPSA | 185.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|