C18H17N7O2 — CID 136734306
3-[N-ethyl-4-[(5-nitro-1H-indazol-3-yl)diazenyl]anilino]propanenitrile (PubChem CID 136734306) has the molecular formula C18H17N7O2 and a molecular weight of 363.38 g/mol. Its IUPAC name is 3-[N-ethyl-4-[(5-nitro-1H-indazol-3-yl)diazenyl]anilino]propanenitrile.
| Compound Name | 3-[N-ethyl-4-[(5-nitro-1H-indazol-3-yl)diazenyl]anilino]propanenitrile |
|---|---|
| PubChem CID | 136734306 |
| Molecular Formula | C18H17N7O2 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 3-[N-ethyl-4-[(5-nitro-1H-indazol-3-yl)diazenyl]anilino]propanenitrile |
| SMILES | CCN(CCC#N)c1ccc(/N=N/c2n[nH]c3ccc([N+](=O)[O-])cc23)cc1 |
| InChI | InChI=1S/C18H17N7O2/c1-2-24(11-3-10-19)14-6-4-13(5-7-14)20-22-18-16-12-15(25(26)27)8-9-17(16)21-23-18/h4-9,12H,2-3,11H2,1H3,(H,21,23)/b22-20+ |
| InChIKey | HBLGHHOFQPRYNG-LSDHQDQOSA-N |
| XLogP | 4.63 |
| TPSA | 123.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|