C20H22N4O4 — CID 18927821
5-[N-ethyl-4-[(4-nitrophenyl)diazenyl]anilino]-2-methylidenepentanoic acid (PubChem CID 18927821) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is 5-[N-ethyl-4-[(4-nitrophenyl)diazenyl]anilino]-2-methylidenepentanoic acid.
| Compound Name | 5-[N-ethyl-4-[(4-nitrophenyl)diazenyl]anilino]-2-methylidenepentanoic acid |
|---|---|
| PubChem CID | 18927821 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 5-[N-ethyl-4-[(4-nitrophenyl)diazenyl]anilino]-2-methylidenepentanoic acid |
| SMILES | C=C(CCCN(CC)c1ccc(/N=N/c2ccc([N+](=O)[O-])cc2)cc1)C(=O)O |
| InChI | InChI=1S/C20H22N4O4/c1-3-23(14-4-5-15(2)20(25)26)18-10-6-16(7-11-18)21-22-17-8-12-19(13-9-17)24(27)28/h6-13H,2-5,14H2,1H3,(H,25,26)/b22-21+ |
| InChIKey | XSWKVWRDLQIDDF-QURGRASLSA-N |
| XLogP | 5.26 |
| TPSA | 108.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|