About 6-[ethyl-[4-[(6-nitro-1,3-benzothiazol-2-yl)diazenyl]naphthalen-1-yl]amino]hexanoic acid
6-[ethyl-[4-[(6-nitro-1,3-benzothiazol-2-yl)diazenyl]naphthalen-1-yl]amino]hexanoic acid (PubChem CID 59611959) has the molecular formula C25H25N5O4S
and a molecular weight of 491.57 g/mol. Its IUPAC name is 6-[ethyl-[4-[(6-nitro-1,3-benzothiazol-2-yl)diazenyl]naphthalen-1-yl]amino]hexanoic acid.
Molecular Properties
| Compound Name | 6-[ethyl-[4-[(6-nitro-1,3-benzothiazol-2-yl)diazenyl]naphthalen-1-yl]amino]hexanoic acid |
| PubChem CID | 59611959 |
| Molecular Formula | C25H25N5O4S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | 6-[ethyl-[4-[(6-nitro-1,3-benzothiazol-2-yl)diazenyl]naphthalen-1-yl]amino]hexanoic acid |
| SMILES | CCN(CCCCCC(=O)O)c1ccc(/N=N/c2nc3ccc([N+](=O)[O-])cc3s2)c2ccccc12 |
| InChI | InChI=1S/C25H25N5O4S/c1-2-29(15-7-3-4-10-24(31)32)22-14-13-20(18-8-5-6-9-19(18)22)27-28-25-26-21-12-11-17(30(33)34)16-23(21)35-25/h5-6,8-9,11-14,16H,2-4,7,10,15H2,1H3,(H,31,32)/b28-27+ |
| InChIKey | CGPRWEZZWAVBRH-BYYHNAKLSA-N |
| XLogP | 7.24 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-[ethyl-[4-[(6-nitro-1,3-benzothiazol-2-yl)diazenyl]naphthalen-1-yl]amino]hexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[ethyl-[4-[(6-nitro-1,3-benzothiazol-2-yl)diazenyl]naphthalen-1-yl]amino]hexanoic acid?
The IUPAC name of 6-[ethyl-[4-[(6-nitro-1,3-benzothiazol-2-yl)diazenyl]naphthalen-1-yl]amino]hexanoic acid (CID 59611959) is 6-[ethyl-[4-[(6-nitro-1,3-benzothiazol-2-yl)diazenyl]naphthalen-1-yl]amino]hexanoic acid.
What is the SMILES notation for 6-[ethyl-[4-[(6-nitro-1,3-benzothiazol-2-yl)diazenyl]naphthalen-1-yl]amino]hexanoic acid?
The canonical SMILES for 6-[ethyl-[4-[(6-nitro-1,3-benzothiazol-2-yl)diazenyl]naphthalen-1-yl]amino]hexanoic acid is CCN(CCCCCC(=O)O)c1ccc(/N=N/c2nc3ccc([N+](=O)[O-])cc3s2)c2ccccc12.
What is the InChIKey of 6-[ethyl-[4-[(6-nitro-1,3-benzothiazol-2-yl)diazenyl]naphthalen-1-yl]amino]hexanoic acid?
The InChIKey is CGPRWEZZWAVBRH-BYYHNAKLSA-N. The full InChI is InChI=1S/C25H25N5O4S/c1-2-29(15-7-3-4-10-24(31)32)22-14-13-20(18-8-5-6-9-19(18)22)27-28-25-26-21-12-11-17(30(33)34)16-23(21)35-25/h5-6,8-9,11-14,16H,2-4,7,10,15H2,1H3,(H,31,32)/b28-27+.
What are the key properties of 6-[ethyl-[4-[(6-nitro-1,3-benzothiazol-2-yl)diazenyl]naphthalen-1-yl]amino]hexanoic acid?
6-[ethyl-[4-[(6-nitro-1,3-benzothiazol-2-yl)diazenyl]naphthalen-1-yl]amino]hexanoic acid has a molecular weight of 491.57 g/mol, XLogP of 7.24, 11 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[ethyl-[4-[(6-nitro-1,3-benzothiazol-2-yl)diazenyl]naphthalen-1-yl]amino]hexanoic acid is sourced from PubChem (CID 59611959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).