C18H18N4O3S — CID 136797804
2-[[4-(diethylamino)-2-hydroxyphenyl]diazenyl]-1,3-benzothiazole-6-carboxylic acid (PubChem CID 136797804) has the molecular formula C18H18N4O3S and a molecular weight of 370.43 g/mol. Its IUPAC name is 2-[[4-(diethylamino)-2-hydroxyphenyl]diazenyl]-1,3-benzothiazole-6-carboxylic acid.
| Compound Name | 2-[[4-(diethylamino)-2-hydroxyphenyl]diazenyl]-1,3-benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 136797804 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 2-[[4-(diethylamino)-2-hydroxyphenyl]diazenyl]-1,3-benzothiazole-6-carboxylic acid |
| SMILES | CCN(CC)c1ccc(/N=N/c2nc3ccc(C(=O)O)cc3s2)c(O)c1 |
| InChI | InChI=1S/C18H18N4O3S/c1-3-22(4-2)12-6-8-13(15(23)10-12)20-21-18-19-14-7-5-11(17(24)25)9-16(14)26-18/h5-10,23H,3-4H2,1-2H3,(H,24,25)/b21-20+ |
| InChIKey | WURSZEIUBNGXPH-QZQOTICOSA-N |
| XLogP | 4.96 |
| TPSA | 98.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|