C9H6N2O2S — CID 145348385
2-(methylideneamino)-1,3-benzothiazole-6-carboxylic acid (PubChem CID 145348385) has the molecular formula C9H6N2O2S and a molecular weight of 206.23 g/mol. Its IUPAC name is 2-(methylideneamino)-1,3-benzothiazole-6-carboxylic acid.
| Compound Name | 2-(methylideneamino)-1,3-benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 145348385 |
| Molecular Formula | C9H6N2O2S |
| Molecular Weight | 206.23 g/mol |
| Exact Mass | 206.01 |
| IUPAC Name | 2-(methylideneamino)-1,3-benzothiazole-6-carboxylic acid |
| SMILES | C=Nc1nc2ccc(C(=O)O)cc2s1 |
| InChI | InChI=1S/C9H6N2O2S/c1-10-9-11-6-3-2-5(8(12)13)4-7(6)14-9/h2-4H,1H2,(H,12,13) |
| InChIKey | AJUSFLZPYOPGBO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.23 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|