C34H40N6O2 — CID 137081566
5-(diethylamino)-2-[[4-[4-[[4-(diethylamino)-2-hydroxyphenyl]diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]phenol (PubChem CID 137081566) has the molecular formula C34H40N6O2 and a molecular weight of 564.73 g/mol. Its IUPAC name is 5-(diethylamino)-2-[[4-[4-[[4-(diethylamino)-2-hydroxyphenyl]diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]phenol.
| Compound Name | 5-(diethylamino)-2-[[4-[4-[[4-(diethylamino)-2-hydroxyphenyl]diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]phenol |
|---|---|
| PubChem CID | 137081566 |
| Molecular Formula | C34H40N6O2 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.32 |
| IUPAC Name | 5-(diethylamino)-2-[[4-[4-[[4-(diethylamino)-2-hydroxyphenyl]diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]phenol |
| SMILES | CCN(CC)c1ccc(/N=N/c2ccc(-c3ccc(/N=N/c4ccc(N(CC)CC)cc4O)c(C)c3)cc2C)c(O)c1 |
| InChI | InChI=1S/C34H40N6O2/c1-7-39(8-2)27-13-17-31(33(41)21-27)37-35-29-15-11-25(19-23(29)5)26-12-16-30(24(6)20-26)36-38-32-18-14-28(22-34(32)42)40(9-3)10-4/h11-22,41-42H,7-10H2,1-6H3/b37-35+,38-36+ |
| InChIKey | XQZXTQSILIYDJG-ATXIYDNESA-N |
| XLogP | 9.90 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|