C15H17BrN4O — CID 136611798
2-[(3-bromo-2-pyridinyl)diazenyl]-5-(diethylamino)phenol (PubChem CID 136611798) has the molecular formula C15H17BrN4O and a molecular weight of 349.23 g/mol. Its IUPAC name is 2-[(3-bromo-2-pyridinyl)diazenyl]-5-(diethylamino)phenol.
| Compound Name | 2-[(3-bromo-2-pyridinyl)diazenyl]-5-(diethylamino)phenol |
|---|---|
| PubChem CID | 136611798 |
| Molecular Formula | C15H17BrN4O |
| Molecular Weight | 349.23 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 2-[(3-bromo-2-pyridinyl)diazenyl]-5-(diethylamino)phenol |
| SMILES | CCN(CC)c1ccc(/N=N/c2ncccc2Br)c(O)c1 |
| InChI | InChI=1S/C15H17BrN4O/c1-3-20(4-2)11-7-8-13(14(21)10-11)18-19-15-12(16)6-5-9-17-15/h5-10,21H,3-4H2,1-2H3/b19-18+ |
| InChIKey | NRICGDKGAUMTBK-VHEBQXMUSA-N |
| XLogP | 4.81 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.23 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|