C16H23N5OS — CID 135829617
2-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)diazenyl]-5-(diethylamino)phenol (PubChem CID 135829617) has the molecular formula C16H23N5OS and a molecular weight of 333.46 g/mol. Its IUPAC name is 2-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)diazenyl]-5-(diethylamino)phenol.
| Compound Name | 2-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)diazenyl]-5-(diethylamino)phenol |
|---|---|
| PubChem CID | 135829617 |
| Molecular Formula | C16H23N5OS |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 2-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)diazenyl]-5-(diethylamino)phenol |
| SMILES | CCN(CC)c1ccc(/N=N/c2nc(C(C)(C)C)ns2)c(O)c1 |
| InChI | InChI=1S/C16H23N5OS/c1-6-21(7-2)11-8-9-12(13(22)10-11)18-19-15-17-14(20-23-15)16(3,4)5/h8-10,22H,6-7H2,1-5H3/b19-18+ |
| InChIKey | RLRIEICBCRIHEB-VHEBQXMUSA-N |
| XLogP | 4.80 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|