C13H14BrN4OS- — CID 20643988
2-[(5-bromo-1,3-thiazol-2-yl)diazenyl]-5-(diethylamino)phenolate (PubChem CID 20643988) has the molecular formula C13H14BrN4OS- and a molecular weight of 354.25 g/mol. Its IUPAC name is 2-[(5-bromo-1,3-thiazol-2-yl)diazenyl]-5-(diethylamino)phenolate.
| Compound Name | 2-[(5-bromo-1,3-thiazol-2-yl)diazenyl]-5-(diethylamino)phenolate |
|---|---|
| PubChem CID | 20643988 |
| Molecular Formula | C13H14BrN4OS- |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | 2-[(5-bromo-1,3-thiazol-2-yl)diazenyl]-5-(diethylamino)phenolate |
| SMILES | CCN(CC)c1ccc(/N=N/c2ncc(Br)s2)c([O-])c1 |
| InChI | InChI=1S/C13H15BrN4OS/c1-3-18(4-2)9-5-6-10(11(19)7-9)16-17-13-15-8-12(14)20-13/h5-8,19H,3-4H2,1-2H3/p-1/b17-16+ |
| InChIKey | RADZBKPGRNBGRM-WUKNDPDISA-M |
| XLogP | 4.24 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|