C9H6BrN3O2S — CID 136759465
4-[(5-bromo-1,3-thiazol-2-yl)diazenyl]benzene-1,3-diol (PubChem CID 136759465) has the molecular formula C9H6BrN3O2S and a molecular weight of 300.14 g/mol. Its IUPAC name is 4-[(5-bromo-1,3-thiazol-2-yl)diazenyl]benzene-1,3-diol.
| Compound Name | 4-[(5-bromo-1,3-thiazol-2-yl)diazenyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 136759465 |
| Molecular Formula | C9H6BrN3O2S |
| Molecular Weight | 300.14 g/mol |
| Exact Mass | 298.94 |
| IUPAC Name | 4-[(5-bromo-1,3-thiazol-2-yl)diazenyl]benzene-1,3-diol |
| SMILES | Oc1ccc(/N=N/c2ncc(Br)s2)c(O)c1 |
| InChI | InChI=1S/C9H6BrN3O2S/c10-8-4-11-9(16-8)13-12-6-2-1-5(14)3-7(6)15/h1-4,14-15H/b13-12+ |
| InChIKey | PPYABIITGLDLCG-OUKQBFOZSA-N |
| XLogP | 3.73 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.14 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|