C12H8ClN3O4 — CID 135554972
4-[(4-chloro-2-nitrophenyl)diazenyl]benzene-1,3-diol (PubChem CID 135554972) has the molecular formula C12H8ClN3O4 and a molecular weight of 293.67 g/mol. Its IUPAC name is 4-[(4-chloro-2-nitrophenyl)diazenyl]benzene-1,3-diol.
| Compound Name | 4-[(4-chloro-2-nitrophenyl)diazenyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 135554972 |
| Molecular Formula | C12H8ClN3O4 |
| Molecular Weight | 293.67 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | 4-[(4-chloro-2-nitrophenyl)diazenyl]benzene-1,3-diol |
| SMILES | O=[N+]([O-])c1cc(Cl)ccc1/N=N/c1ccc(O)cc1O |
| InChI | InChI=1S/C12H8ClN3O4/c13-7-1-3-9(11(5-7)16(19)20)14-15-10-4-2-8(17)6-12(10)18/h1-6,17-18H/b15-14+ |
| InChIKey | AGONQPRWSIKHPM-CCEZHUSRSA-N |
| XLogP | 4.07 |
| TPSA | 108.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.67 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|