C31H28Cl2N6O8 — CID 139809284
2-[(4-chloro-2-nitrophenyl)diazenyl]-6-[3-[3-[(4-chloro-2-nitrophenyl)diazenyl]-2-hydroxy-5-(2-hydroxyethyl)phenyl]propyl]-4-(2-hydroxyethyl)phenol (PubChem CID 139809284) has the molecular formula C31H28Cl2N6O8 and a molecular weight of 683.51 g/mol. Its IUPAC name is 2-[(4-chloro-2-nitrophenyl)diazenyl]-6-[3-[3-[(4-chloro-2-nitrophenyl)diazenyl]-2-hydroxy-5-(2-hydroxyethyl)phenyl]propyl]-4-(2-hydroxyethyl)phenol.
| Compound Name | 2-[(4-chloro-2-nitrophenyl)diazenyl]-6-[3-[3-[(4-chloro-2-nitrophenyl)diazenyl]-2-hydroxy-5-(2-hydroxyethyl)phenyl]propyl]-4-(2-hydroxyethyl)phenol |
|---|---|
| PubChem CID | 139809284 |
| Molecular Formula | C31H28Cl2N6O8 |
| Molecular Weight | 683.51 g/mol |
| Exact Mass | 682.13 |
| IUPAC Name | 2-[(4-chloro-2-nitrophenyl)diazenyl]-6-[3-[3-[(4-chloro-2-nitrophenyl)diazenyl]-2-hydroxy-5-(2-hydroxyethyl)phenyl]propyl]-4-(2-hydroxyethyl)phenol |
| SMILES | O=[N+]([O-])c1cc(Cl)ccc1/N=N/c1cc(CCO)cc(CCCc2cc(CCO)cc(/N=N/c3ccc(Cl)cc3[N+](=O)[O-])c2O)c1O |
| InChI | InChI=1S/C31H28Cl2N6O8/c32-22-4-6-24(28(16-22)38(44)45)34-36-26-14-18(8-10-40)12-20(30(26)42)2-1-3-21-13-19(9-11-41)15-27(31(21)43)37-35-25-7-5-23(33)17-29(25)39(46)47/h4-7,12-17,40-43H,1-3,8-11H2/b36-34+,37-35+ |
| InChIKey | LHPCEMIZVGTTBG-VHJMTFITSA-N |
| XLogP | 8.30 |
| TPSA | 216.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.51 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|