C11H9N3O2Ti+4 — CID 158518155
4-(pyridin-2-yldiazenyl)benzene-1,3-diol;titanium(4+) (PubChem CID 158518155) has the molecular formula C11H9N3O2Ti+4 and a molecular weight of 263.08 g/mol. Its IUPAC name is 4-(pyridin-2-yldiazenyl)benzene-1,3-diol;titanium(4+).
| Compound Name | 4-(pyridin-2-yldiazenyl)benzene-1,3-diol;titanium(4+) |
|---|---|
| PubChem CID | 158518155 |
| Molecular Formula | C11H9N3O2Ti+4 |
| Molecular Weight | 263.08 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | 4-(pyridin-2-yldiazenyl)benzene-1,3-diol;titanium(4+) |
| SMILES | Oc1ccc(/N=N/c2ccccn2)c(O)c1.[Ti+4] |
| InChI | InChI=1S/C11H9N3O2.Ti/c15-8-4-5-9(10(16)7-8)13-14-11-3-1-2-6-12-11;/h1-7,15-16H;/q;+4/b14-13+; |
| InChIKey | HLWPHPLRQAEUMH-IERUDJENSA-N |
| XLogP | 2.91 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.08 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|