About dipyridin-2-yldiazene;osmium
dipyridin-2-yldiazene;osmium (PubChem CID 173074203) has the molecular formula C10H8N4Os
and a molecular weight of 374.43 g/mol. Its IUPAC name is dipyridin-2-yldiazene;osmium.
Molecular Properties
| Compound Name | dipyridin-2-yldiazene;osmium |
| PubChem CID | 173074203 |
| Molecular Formula | C10H8N4Os |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | dipyridin-2-yldiazene;osmium |
| SMILES | [Os].c1ccc(N=Nc2ccccn2)nc1 |
| InChI | InChI=1S/C10H8N4.Os/c1-3-7-11-9(5-1)13-14-10-6-2-4-8-12-10;/h1-8H; |
| InChIKey | YZZKRBPOBVXUKS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze dipyridin-2-yldiazene;osmium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipyridin-2-yldiazene;osmium?
The IUPAC name of dipyridin-2-yldiazene;osmium (CID 173074203) is dipyridin-2-yldiazene;osmium.
What is the SMILES notation for dipyridin-2-yldiazene;osmium?
The canonical SMILES for dipyridin-2-yldiazene;osmium is [Os].c1ccc(N=Nc2ccccn2)nc1.
What is the InChIKey of dipyridin-2-yldiazene;osmium?
The InChIKey is YZZKRBPOBVXUKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N4.Os/c1-3-7-11-9(5-1)13-14-10-6-2-4-8-12-10;/h1-8H;.
What are the key properties of dipyridin-2-yldiazene;osmium?
dipyridin-2-yldiazene;osmium has a molecular weight of 374.43 g/mol, XLogP of 2.89, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dipyridin-2-yldiazene;osmium is sourced from PubChem (CID 173074203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).