C11H11N3Na2O4 — CID 2735125
disodium;4-(pyridin-2-yldiazenyl)benzene-1,3-diolate;dihydrate (PubChem CID 2735125) has the molecular formula C11H11N3Na2O4 and a molecular weight of 295.21 g/mol. Its IUPAC name is disodium;4-(pyridin-2-yldiazenyl)benzene-1,3-diolate;dihydrate.
| Compound Name | disodium;4-(pyridin-2-yldiazenyl)benzene-1,3-diolate;dihydrate |
|---|---|
| PubChem CID | 2735125 |
| Molecular Formula | C11H11N3Na2O4 |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | disodium;4-(pyridin-2-yldiazenyl)benzene-1,3-diolate;dihydrate |
| SMILES | O.O.[Na+].[Na+].[O-]c1ccc(/N=N/c2ccccn2)c([O-])c1 |
| InChI | InChI=1S/C11H9N3O2.2Na.2H2O/c15-8-4-5-9(10(16)7-8)13-14-11-3-1-2-6-12-11;;;;/h1-7,15-16H;;;2*1H2/q;2*+1;;/p-2/b14-13+;;;; |
| InChIKey | VEKNNRJLPYCKOU-XURWPRCOSA-L |
| XLogP | -6.00 |
| TPSA | 146.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | -6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|