C11H7Cl2N3 — CID 102225413
(2,6-dichlorophenyl)-pyridin-2-yldiazene (PubChem CID 102225413) has the molecular formula C11H7Cl2N3 and a molecular weight of 252.10 g/mol. Its IUPAC name is (2,6-dichlorophenyl)-pyridin-2-yldiazene.
| Compound Name | (2,6-dichlorophenyl)-pyridin-2-yldiazene |
|---|---|
| PubChem CID | 102225413 |
| Molecular Formula | C11H7Cl2N3 |
| Molecular Weight | 252.10 g/mol |
| Exact Mass | 251.00 |
| IUPAC Name | (2,6-dichlorophenyl)-pyridin-2-yldiazene |
| SMILES | Clc1cccc(Cl)c1/N=N/c1ccccn1 |
| InChI | InChI=1S/C11H7Cl2N3/c12-8-4-3-5-9(13)11(8)16-15-10-6-1-2-7-14-10/h1-7H/b16-15+ |
| InChIKey | NNDHYJNBQHSBPF-FOCLMDBBSA-N |
| XLogP | 4.80 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.10 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|